Mercurial > projects > ldc
view ir/irlandingpad.cpp @ 1648:18bbb1436153 0.9.2
Change the ldc.conf file output to match the newer Tango directory structure and only use libtango-user-ldc for the libs to match the 0.99.9 build instructions.
author | Kelly Wilson <wilsonk cpsc.ucalgary.ca> |
---|---|
date | Wed, 10 Mar 2010 20:21:05 -0700 |
parents | f4c56ed32238 |
children | 40bd4a0d4870 |
line wrap: on
line source
#include "gen/llvm.h" #include "gen/tollvm.h" #include "gen/irstate.h" #include "gen/runtime.h" #include "gen/logger.h" #include "gen/classes.h" #include "gen/llvmhelpers.h" #include "ir/irlandingpad.h" IRLandingPadInfo::IRLandingPadInfo(Catch* catchstmt, llvm::BasicBlock* end) : finallyBody(NULL) { target = llvm::BasicBlock::Create(gIR->context(), "catch", gIR->topfunc(), end); gIR->scope() = IRScope(target,end); // assign storage to catch var if(catchstmt->var) { // use the same storage for all exceptions that are not accessed in // nested functions #if DMDV2 if(!catchstmt->var->nestedrefs.dim) { #else if(!catchstmt->var->nestedref) { #endif assert(!catchstmt->var->ir.irLocal); catchstmt->var->ir.irLocal = new IrLocal(catchstmt->var); LLValue* catch_var = gIR->func()->gen->landingPadInfo.getExceptionStorage(); catchstmt->var->ir.irLocal->value = gIR->ir->CreateBitCast(catch_var, getPtrToType(DtoType(catchstmt->var->type))); } // this will alloca if we haven't already and take care of nested refs DtoDeclarationExp(catchstmt->var); // the exception will only be stored in catch_var. copy it over if necessary if(catchstmt->var->ir.irLocal->value != gIR->func()->gen->landingPadInfo.getExceptionStorage()) { LLValue* exc = gIR->ir->CreateBitCast(DtoLoad(gIR->func()->gen->landingPadInfo.getExceptionStorage()), DtoType(catchstmt->var->type)); DtoStore(exc, catchstmt->var->ir.irLocal->value); } } // emit handler, if there is one // handler is zero for instance for 'catch { debug foo(); }' if(catchstmt->handler) catchstmt->handler->toIR(gIR); if (!gIR->scopereturned()) gIR->ir->CreateBr(end); assert(catchstmt->type); catchType = catchstmt->type->toBasetype()->isClassHandle(); assert(catchType); catchType->codegen(Type::sir); } IRLandingPadInfo::IRLandingPadInfo(Statement* finallystmt) : target(NULL), finallyBody(finallystmt), catchType(NULL) { } void IRLandingPad::addCatch(Catch* catchstmt, llvm::BasicBlock* end) { unpushed_infos.push_front(IRLandingPadInfo(catchstmt, end)); } void IRLandingPad::addFinally(Statement* finallystmt) { unpushed_infos.push_front(IRLandingPadInfo(finallystmt)); } void IRLandingPad::push(llvm::BasicBlock* inBB) { // store infos such that matches are right to left nInfos.push(infos.size()); infos.insert(infos.end(), unpushed_infos.begin(), unpushed_infos.end()); unpushed_infos.clear(); constructLandingPad(inBB); // store as invoke target padBBs.push(inBB); } void IRLandingPad::pop() { padBBs.pop(); size_t n = nInfos.top(); infos.resize(n); nInfos.pop(); } llvm::BasicBlock* IRLandingPad::get() { if(padBBs.size() == 0) return NULL; else return padBBs.top(); } void IRLandingPad::constructLandingPad(llvm::BasicBlock* inBB) { // save and rewrite scope IRScope savedscope = gIR->scope(); gIR->scope() = IRScope(inBB,savedscope.end); // eh_ptr = llvm.eh.exception(); llvm::Function* eh_exception_fn = GET_INTRINSIC_DECL(eh_exception); LLValue* eh_ptr = gIR->ir->CreateCall(eh_exception_fn); // build selector arguments LLSmallVector<LLValue*, 6> selectorargs; // put in classinfos in the right order bool hasFinally = false; std::deque<IRLandingPadInfo>::iterator it = infos.begin(), end = infos.end(); for(; it != end; ++it) { if(it->finallyBody) hasFinally = true; else { if(catchToInt.find(it->catchType) == catchToInt.end()) { int newval = 1 + catchToInt.size(); catchToInt[it->catchType] = newval; } assert(it->catchType); assert(it->catchType->ir.irStruct); selectorargs.insert(selectorargs.begin(), it->catchType->ir.irStruct->getClassInfoSymbol()); } } // if there's a finally, the eh table has to have a 0 action if(hasFinally) selectorargs.push_back(DtoConstSize_t(0));//LLConstantInt::get(LLType::getInt32Ty(gIR->context()), 0)); // personality fn llvm::Function* personality_fn = LLVM_D_GetRuntimeFunction(gIR->module, "_d_eh_personality"); LLValue* personality_fn_arg = gIR->ir->CreateBitCast(personality_fn, getPtrToType(LLType::getInt8Ty(gIR->context()))); selectorargs.insert(selectorargs.begin(), personality_fn_arg); // eh storage target selectorargs.insert(selectorargs.begin(), eh_ptr); // if there is a catch and some catch allocated storage, store exception object if(catchToInt.size() && catch_var) { const LLType* objectTy = DtoType(ClassDeclaration::object->type); gIR->ir->CreateStore(gIR->ir->CreateBitCast(eh_ptr, objectTy), catch_var); } // eh_sel = llvm.eh.selector(eh_ptr, cast(byte*)&_d_eh_personality, <selectorargs>); llvm::Function* eh_selector_fn; if (global.params.is64bit) eh_selector_fn = GET_INTRINSIC_DECL(eh_selector_i64); else eh_selector_fn = GET_INTRINSIC_DECL(eh_selector_i32); LLValue* eh_sel = gIR->ir->CreateCall(eh_selector_fn, selectorargs.begin(), selectorargs.end()); // emit finallys and switches that branch to catches until there are no more catches // then simply branch to the finally chain llvm::SwitchInst* switchinst = NULL; std::deque<IRLandingPadInfo>::reverse_iterator rit, rend = infos.rend(); for(rit = infos.rbegin(); rit != rend; ++rit) { // if it's a finally, emit its code if(rit->finallyBody) { if(switchinst) switchinst = NULL; // since this may be emitted multiple times // give the labels a new scope gIR->func()->gen->pushUniqueLabelScope("finally"); rit->finallyBody->toIR(gIR); gIR->func()->gen->popLabelScope(); } // otherwise it's a catch and we'll add a switch case else { if(!switchinst) { switchinst = gIR->ir->CreateSwitch(eh_sel, llvm::BasicBlock::Create(gIR->context(), "switchdefault", gIR->topfunc(), gIR->scopeend()), infos.size()); gIR->scope() = IRScope(switchinst->getDefaultDest(), gIR->scopeend()); } // dubious comment // catches matched first get the largest switchval, so do size - unique int llvm::ConstantInt* switchval = LLConstantInt::get(DtoSize_t(), catchToInt[rit->catchType]); // and make sure we don't add the same switchval twice, may happen with nested trys if(!switchinst->findCaseValue(switchval)) switchinst->addCase(switchval, rit->target); } } // no catch matched and all finallys executed - resume unwind llvm::Function* unwind_resume_fn = LLVM_D_GetRuntimeFunction(gIR->module, "_d_eh_resume_unwind"); gIR->ir->CreateCall(unwind_resume_fn, eh_ptr); gIR->ir->CreateUnreachable(); gIR->scope() = savedscope; } LLValue* IRLandingPad::getExceptionStorage() { if(!catch_var) { Logger::println("Making new catch var"); catch_var = DtoAlloca(ClassDeclaration::object->type, "catchvar"); } return catch_var; }